C24H30ClFN6O4 — CID 177333994
tert-butyl (1S,2S,3S,14R)-7-chloro-8-fluoro-3-methyl-9-[(1-methylimidazol-4-yl)methylamino]-11-oxo-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-triene-17-carboxylate (PubChem CID 177333994) has the molecular formula C24H30ClFN6O4 and a molecular weight of 520.99 g/mol. Its IUPAC name is tert-butyl (1S,2S,3S,14R)-7-chloro-8-fluoro-3-methyl-9-[(1-methylimidazol-4-yl)methylamino]-11-oxo-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-triene-17-carboxylate.
| Compound Name | tert-butyl (1S,2S,3S,14R)-7-chloro-8-fluoro-3-methyl-9-[(1-methylimidazol-4-yl)methylamino]-11-oxo-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-triene-17-carboxylate |
|---|---|
| PubChem CID | 177333994 |
| Molecular Formula | C24H30ClFN6O4 |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | tert-butyl (1S,2S,3S,14R)-7-chloro-8-fluoro-3-methyl-9-[(1-methylimidazol-4-yl)methylamino]-11-oxo-4-oxa-6,12,17-triazatetracyclo[12.2.1.02,12.05,10]heptadeca-5,7,9-triene-17-carboxylate |
| SMILES | C[C@@H]1Oc2nc(Cl)c(F)c(NCc3cn(C)cn3)c2C(=O)N2C[C@H]3CC[C@@H]([C@@H]12)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30ClFN6O4/c1-12-19-15-7-6-14(32(15)23(34)36-24(2,3)4)10-31(19)22(33)16-18(17(26)20(25)29-21(16)35-12)27-8-13-9-30(5)11-28-13/h9,11-12,14-15,19H,6-8,10H2,1-5H3,(H,27,29)/t12-,14+,15-,19+/m0/s1 |
| InChIKey | LAORDNPQBWHIJJ-OUFKLWKOSA-N |
| XLogP | 3.59 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|