About ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one
ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one (PubChem CID 177334069) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 177334069 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one |
| SMILES | CC.CC(C)c1ccc(-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C11H12N2O2.C2H6/c1-7(2)8-3-5-9(6-4-8)10-12-11(14)15-13-10;1-2/h3-7H,1-2H3,(H,12,13,14);1-2H3 |
| InChIKey | PXJPKUQCFSOMLY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one (CID 177334069) is ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one is CC.CC(C)c1ccc(-c2noc(=O)[nH]2)cc1.
What is the InChIKey of ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one?
The InChIKey is PXJPKUQCFSOMLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2.C2H6/c1-7(2)8-3-5-9(6-4-8)10-12-11(14)15-13-10;1-2/h3-7H,1-2H3,(H,12,13,14);1-2H3.
What are the key properties of ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one?
ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one has a molecular weight of 234.30 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(4-propan-2-ylphenyl)-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 177334069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).