C12H11N3O2 — CID 166734667
3-(1,3-dimethylindol-5-yl)-4H-1,2,4-oxadiazol-5-one (PubChem CID 166734667) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-(1,3-dimethylindol-5-yl)-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-(1,3-dimethylindol-5-yl)-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 166734667 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(1,3-dimethylindol-5-yl)-4H-1,2,4-oxadiazol-5-one |
| SMILES | Cc1cn(C)c2ccc(-c3noc(=O)[nH]3)cc12 |
| InChI | InChI=1S/C12H11N3O2/c1-7-6-15(2)10-4-3-8(5-9(7)10)11-13-12(16)17-14-11/h3-6H,1-2H3,(H,13,14,16) |
| InChIKey | KFONZMNSLCAQSF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |