About 7-bromo-4-methylpyrazolo[1,5-a]quinoline
7-bromo-4-methylpyrazolo[1,5-a]quinoline (PubChem CID 177334866) has the molecular formula C12H9BrN2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 7-bromo-4-methylpyrazolo[1,5-a]quinoline.
Molecular Properties
| Compound Name | 7-bromo-4-methylpyrazolo[1,5-a]quinoline |
| PubChem CID | 177334866 |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 7-bromo-4-methylpyrazolo[1,5-a]quinoline |
| SMILES | Cc1cc2cc(Br)ccc2n2nccc12 |
| InChI | InChI=1S/C12H9BrN2/c1-8-6-9-7-10(13)2-3-12(9)15-11(8)4-5-14-15/h2-7H,1H3 |
| InChIKey | RFVISFWGDHKVCK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-4-methylpyrazolo[1,5-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-methylpyrazolo[1,5-a]quinoline?
The IUPAC name of 7-bromo-4-methylpyrazolo[1,5-a]quinoline (CID 177334866) is 7-bromo-4-methylpyrazolo[1,5-a]quinoline.
What is the SMILES notation for 7-bromo-4-methylpyrazolo[1,5-a]quinoline?
The canonical SMILES for 7-bromo-4-methylpyrazolo[1,5-a]quinoline is Cc1cc2cc(Br)ccc2n2nccc12.
What is the InChIKey of 7-bromo-4-methylpyrazolo[1,5-a]quinoline?
The InChIKey is RFVISFWGDHKVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN2/c1-8-6-9-7-10(13)2-3-12(9)15-11(8)4-5-14-15/h2-7H,1H3.
What are the key properties of 7-bromo-4-methylpyrazolo[1,5-a]quinoline?
7-bromo-4-methylpyrazolo[1,5-a]quinoline has a molecular weight of 261.12 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-methylpyrazolo[1,5-a]quinoline is sourced from PubChem (CID 177334866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).