C33H37F2N5O4 — CID 177335108
N-[[2-[[4-[[4-(4-cyano-3-fluorophenyl)piperazin-1-yl]methyl]-2-fluorophenyl]methoxy]-6-methylphenyl]methyl]-N-[(1R)-1-(methylaminooxy)-4-oxobutyl]formamide (PubChem CID 177335108) has the molecular formula C33H37F2N5O4 and a molecular weight of 605.69 g/mol. Its IUPAC name is N-[[2-[[4-[[4-(4-cyano-3-fluorophenyl)piperazin-1-yl]methyl]-2-fluorophenyl]methoxy]-6-methylphenyl]methyl]-N-[(1R)-1-(methylaminooxy)-4-oxobutyl]formamide.
| Compound Name | N-[[2-[[4-[[4-(4-cyano-3-fluorophenyl)piperazin-1-yl]methyl]-2-fluorophenyl]methoxy]-6-methylphenyl]methyl]-N-[(1R)-1-(methylaminooxy)-4-oxobutyl]formamide |
|---|---|
| PubChem CID | 177335108 |
| Molecular Formula | C33H37F2N5O4 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | N-[[2-[[4-[[4-(4-cyano-3-fluorophenyl)piperazin-1-yl]methyl]-2-fluorophenyl]methoxy]-6-methylphenyl]methyl]-N-[(1R)-1-(methylaminooxy)-4-oxobutyl]formamide |
| SMILES | CNO[C@H](CCC=O)N(C=O)Cc1c(C)cccc1OCc1ccc(CN2CCN(c3ccc(C#N)c(F)c3)CC2)cc1F |
| InChI | InChI=1S/C33H37F2N5O4/c1-24-5-3-6-32(29(24)21-40(23-42)33(44-37-2)7-4-16-41)43-22-27-9-8-25(17-30(27)34)20-38-12-14-39(15-13-38)28-11-10-26(19-36)31(35)18-28/h3,5-6,8-11,16-18,23,33,37H,4,7,12-15,20-22H2,1-2H3/t33-/m1/s1 |
| InChIKey | MZVPSPNKZGIOBS-MGBGTMOVSA-N |
| XLogP | 4.46 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|