C28H36FN3O6 — CID 130389081
N-[2-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-2-hydroxyacetyl]propanamide (PubChem CID 130389081) has the molecular formula C28H36FN3O6 and a molecular weight of 529.61 g/mol. Its IUPAC name is N-[2-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-2-hydroxyacetyl]propanamide.
| Compound Name | N-[2-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-2-hydroxyacetyl]propanamide |
|---|---|
| PubChem CID | 130389081 |
| Molecular Formula | C28H36FN3O6 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | N-[2-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-2-hydroxyacetyl]propanamide |
| SMILES | CCC(=O)NC(=O)C(O)N(C)Cc1c(C=O)cccc1OCc1ccc(CN2CC(C)OC(C)C2)cc1F |
| InChI | InChI=1S/C28H36FN3O6/c1-5-26(34)30-27(35)28(36)31(4)15-23-21(16-33)7-6-8-25(23)37-17-22-10-9-20(11-24(22)29)14-32-12-18(2)38-19(3)13-32/h6-11,16,18-19,28,36H,5,12-15,17H2,1-4H3,(H,30,34,35) |
| InChIKey | GHFCVSCOTRVVMT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|