C31H43FN4O7 — CID 145070393
4-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2,2,3,3,4-pentahydroxy-5-(methylamino)hex-5-enal (PubChem CID 145070393) has the molecular formula C31H43FN4O7 and a molecular weight of 602.70 g/mol. Its IUPAC name is 4-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2,2,3,3,4-pentahydroxy-5-(methylamino)hex-5-enal.
| Compound Name | 4-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2,2,3,3,4-pentahydroxy-5-(methylamino)hex-5-enal |
|---|---|
| PubChem CID | 145070393 |
| Molecular Formula | C31H43FN4O7 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 4-[[2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2,2,3,3,4-pentahydroxy-5-(methylamino)hex-5-enal |
| SMILES | C=CN(Cc1c(C)cccc1NCc1ccc(CN2CC(C)OC(C)C2)cc1F)C(O)(C(=C)NC)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C31H43FN4O7/c1-7-36(30(40,23(5)33-6)31(41,42)29(38,39)19-37)18-26-20(2)9-8-10-28(26)34-14-25-12-11-24(13-27(25)32)17-35-15-21(3)43-22(4)16-35/h7-13,19,21-22,33-34,38-42H,1,5,14-18H2,2-4,6H3 |
| InChIKey | AYOFRQVNOYPACI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 157.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|