C33H46FN3O4 — CID 145070274
2-[dihydroxy-[3-hydroxyhepta-1,6-dien-3-yl(methyl)amino]methyl]-3-[[2-fluoro-4-[(3,3,5,5-tetramethylpiperidin-1-yl)methyl]phenyl]methylamino]benzaldehyde (PubChem CID 145070274) has the molecular formula C33H46FN3O4 and a molecular weight of 567.75 g/mol. Its IUPAC name is 2-[dihydroxy-[3-hydroxyhepta-1,6-dien-3-yl(methyl)amino]methyl]-3-[[2-fluoro-4-[(3,3,5,5-tetramethylpiperidin-1-yl)methyl]phenyl]methylamino]benzaldehyde.
| Compound Name | 2-[dihydroxy-[3-hydroxyhepta-1,6-dien-3-yl(methyl)amino]methyl]-3-[[2-fluoro-4-[(3,3,5,5-tetramethylpiperidin-1-yl)methyl]phenyl]methylamino]benzaldehyde |
|---|---|
| PubChem CID | 145070274 |
| Molecular Formula | C33H46FN3O4 |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.35 |
| IUPAC Name | 2-[dihydroxy-[3-hydroxyhepta-1,6-dien-3-yl(methyl)amino]methyl]-3-[[2-fluoro-4-[(3,3,5,5-tetramethylpiperidin-1-yl)methyl]phenyl]methylamino]benzaldehyde |
| SMILES | C=CCCC(O)(C=C)N(C)C(O)(O)c1c(C=O)cccc1NCc1ccc(CN2CC(C)(C)CC(C)(C)C2)cc1F |
| InChI | InChI=1S/C33H46FN3O4/c1-8-10-16-32(39,9-2)36(7)33(40,41)29-26(20-38)12-11-13-28(29)35-18-25-15-14-24(17-27(25)34)19-37-22-30(3,4)21-31(5,6)23-37/h8-9,11-15,17,20,35,39-41H,1-2,10,16,18-19,21-23H2,3-7H3 |
| InChIKey | AGTNFCCHCRILOT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|