C21H19F3N7NaO — CID 177336069
sodium;7-[6-(cyclopentylamino)-3-pyridinyl]imidazo[1,2-a]pyrazin-8-one;5-(trifluoromethyl)-2H-pyrimidin-2-ide (PubChem CID 177336069) has the molecular formula C21H19F3N7NaO and a molecular weight of 465.42 g/mol. Its IUPAC name is sodium;7-[6-(cyclopentylamino)-3-pyridinyl]imidazo[1,2-a]pyrazin-8-one;5-(trifluoromethyl)-2H-pyrimidin-2-ide.
| Compound Name | sodium;7-[6-(cyclopentylamino)-3-pyridinyl]imidazo[1,2-a]pyrazin-8-one;5-(trifluoromethyl)-2H-pyrimidin-2-ide |
|---|---|
| PubChem CID | 177336069 |
| Molecular Formula | C21H19F3N7NaO |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | sodium;7-[6-(cyclopentylamino)-3-pyridinyl]imidazo[1,2-a]pyrazin-8-one;5-(trifluoromethyl)-2H-pyrimidin-2-ide |
| SMILES | FC(F)(F)c1cn[c-]nc1.O=c1c2nccn2ccn1-c1ccc(NC2CCCC2)nc1.[Na+] |
| InChI | InChI=1S/C16H17N5O.C5H2F3N2.Na/c22-16-15-17-7-8-20(15)9-10-21(16)13-5-6-14(18-11-13)19-12-3-1-2-4-12;6-5(7,8)4-1-9-3-10-2-4;/h5-12H,1-4H2,(H,18,19);1-2H;/q;-1;+1 |
| InChIKey | AQJIRSXXEZSJCJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|