C21H22F2N5NaO3 — CID 171100958
sodium;1-[6-(cyclopentylamino)-3-pyridinyl]-3-methoxypyridin-2-one;5-(difluoromethoxy)-2H-pyrazin-2-ide (PubChem CID 171100958) has the molecular formula C21H22F2N5NaO3 and a molecular weight of 453.43 g/mol. Its IUPAC name is sodium;1-[6-(cyclopentylamino)-3-pyridinyl]-3-methoxypyridin-2-one;5-(difluoromethoxy)-2H-pyrazin-2-ide.
| Compound Name | sodium;1-[6-(cyclopentylamino)-3-pyridinyl]-3-methoxypyridin-2-one;5-(difluoromethoxy)-2H-pyrazin-2-ide |
|---|---|
| PubChem CID | 171100958 |
| Molecular Formula | C21H22F2N5NaO3 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | sodium;1-[6-(cyclopentylamino)-3-pyridinyl]-3-methoxypyridin-2-one;5-(difluoromethoxy)-2H-pyrazin-2-ide |
| SMILES | COc1cccn(-c2ccc(NC3CCCC3)nc2)c1=O.FC(F)Oc1cn[c-]cn1.[Na+] |
| InChI | InChI=1S/C16H19N3O2.C5H3F2N2O.Na/c1-21-14-7-4-10-19(16(14)20)13-8-9-15(17-11-13)18-12-5-2-3-6-12;6-5(7)10-4-3-8-1-2-9-4;/h4,7-12H,2-3,5-6H2,1H3,(H,17,18);2-3,5H;/q;-1;+1 |
| InChIKey | IANNIWLVIIHXAG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|