About ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate
ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate (PubChem CID 177337689) has the molecular formula C18H25F3N2O3
and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate |
| PubChem CID | 177337689 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C[C@@H](C)N(Cc2ccc(OC(F)(F)F)cc2)[C@@H](C)C1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-4-25-17(24)12-22-9-13(2)23(14(3)10-22)11-15-5-7-16(8-6-15)26-18(19,20)21/h5-8,13-14H,4,9-12H2,1-3H3/t13-,14+ |
| InChIKey | BYQZNGSFSAOZJC-OKILXGFUSA-N |
| XLogP | 3.04 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate?
The IUPAC name of ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate (CID 177337689) is ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate.
What is the SMILES notation for ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate?
The canonical SMILES for ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate is CCOC(=O)CN1C[C@@H](C)N(Cc2ccc(OC(F)(F)F)cc2)[C@@H](C)C1.
What is the InChIKey of ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate?
The InChIKey is BYQZNGSFSAOZJC-OKILXGFUSA-N. The full InChI is InChI=1S/C18H25F3N2O3/c1-4-25-17(24)12-22-9-13(2)23(14(3)10-22)11-15-5-7-16(8-6-15)26-18(19,20)21/h5-8,13-14H,4,9-12H2,1-3H3/t13-,14+.
What are the key properties of ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate?
ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate has a molecular weight of 374.40 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3S,5R)-3,5-dimethyl-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetate is sourced from PubChem (CID 177337689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).