C15H34N2O2 — CID 177340489
ethane;4-ethyl-1-(2-methoxyethyl)-4-propylimidazolidin-2-one (PubChem CID 177340489) has the molecular formula C15H34N2O2 and a molecular weight of 274.45 g/mol. Its IUPAC name is ethane;4-ethyl-1-(2-methoxyethyl)-4-propylimidazolidin-2-one.
| Compound Name | ethane;4-ethyl-1-(2-methoxyethyl)-4-propylimidazolidin-2-one |
|---|---|
| PubChem CID | 177340489 |
| Molecular Formula | C15H34N2O2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | ethane;4-ethyl-1-(2-methoxyethyl)-4-propylimidazolidin-2-one |
| SMILES | CC.CC.CCCC1(CC)CN(CCOC)C(=O)N1 |
| InChI | InChI=1S/C11H22N2O2.2C2H6/c1-4-6-11(5-2)9-13(7-8-15-3)10(14)12-11;2*1-2/h4-9H2,1-3H3,(H,12,14);2*1-2H3 |
| InChIKey | AJHSZEYVLRNFHA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |