C21H31N3O8 — CID 177341711
(4aR,6S,7S,8S,8aR)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 177341711) has the molecular formula C21H31N3O8 and a molecular weight of 453.49 g/mol. Its IUPAC name is (4aR,6S,7S,8S,8aR)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7S,8S,8aR)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 177341711 |
| Molecular Formula | C21H31N3O8 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (4aR,6S,7S,8S,8aR)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H](OCCOCCOCCN=[N+]=[N-])O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C21H31N3O8/c1-25-18-17-16(14-30-20(32-17)15-6-4-3-5-7-15)31-21(19(18)26-2)29-13-12-28-11-10-27-9-8-23-24-22/h3-7,16-21H,8-14H2,1-2H3/t16-,17-,18+,19+,20?,21+/m1/s1 |
| InChIKey | PPLXVAKLQKFTIG-FLMUUJIESA-N |
| XLogP | 2.22 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|