About N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine
N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine (PubChem CID 177342052) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine |
| PubChem CID | 177342052 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine |
| SMILES | COC1COCC1N(C)CN |
| InChI | InChI=1S/C7H16N2O2/c1-9(5-8)6-3-11-4-7(6)10-2/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | ZTNKSLRCLQBCMH-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine?
The IUPAC name of N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine (CID 177342052) is N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine.
What is the SMILES notation for N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine?
The canonical SMILES for N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine is COC1COCC1N(C)CN.
What is the InChIKey of N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine?
The InChIKey is ZTNKSLRCLQBCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-9(5-8)6-3-11-4-7(6)10-2/h6-7H,3-5,8H2,1-2H3.
What are the key properties of N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine?
N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine has a molecular weight of 160.22 g/mol, XLogP of -0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-methoxyoxolan-3-yl)-N'-methylmethanediamine is sourced from PubChem (CID 177342052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).