C9H20N2O2 — CID 11298418
(3R,4R)-4-N-(2-methoxyethyl)-3-N,3-N-dimethyloxolane-3,4-diamine (PubChem CID 11298418) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (3R,4R)-4-N-(2-methoxyethyl)-3-N,3-N-dimethyloxolane-3,4-diamine.
| Compound Name | (3R,4R)-4-N-(2-methoxyethyl)-3-N,3-N-dimethyloxolane-3,4-diamine |
|---|---|
| PubChem CID | 11298418 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | (3R,4R)-4-N-(2-methoxyethyl)-3-N,3-N-dimethyloxolane-3,4-diamine |
| SMILES | COCCN[C@H]1COC[C@@H]1N(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-11(2)9-7-13-6-8(9)10-4-5-12-3/h8-10H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | IVAQKWANYRESKJ-IUCAKERBSA-N |
| XLogP | -0.45 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|