C15H21NO5 — CID 171147056
N-[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]-3-(furan-2-yl)-N-methylprop-2-enamide (PubChem CID 171147056) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]-3-(furan-2-yl)-N-methylprop-2-enamide.
| Compound Name | N-[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]-3-(furan-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 171147056 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]-3-(furan-2-yl)-N-methylprop-2-enamide |
| SMILES | CO[C@H]1[C@H](N(C)C(=O)C=Cc2ccco2)COC[C@H]1OC |
| InChI | InChI=1S/C15H21NO5/c1-16(14(17)7-6-11-5-4-8-21-11)12-9-20-10-13(18-2)15(12)19-3/h4-8,12-13,15H,9-10H2,1-3H3/t12-,13-,15+/m1/s1 |
| InChIKey | VPWJKZTZDNUYSU-NFAWXSAZSA-N |
| XLogP | 1.18 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|