C14H19NO5 — CID 155996619
(E)-N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-methylprop-2-enamide (PubChem CID 155996619) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (E)-N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 155996619 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (E)-N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-methylprop-2-enamide |
| SMILES | CN(C[C@@H]1COC[C@@H](O)[C@H]1O)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C14H19NO5/c1-15(7-10-8-19-9-12(16)14(10)18)13(17)5-4-11-3-2-6-20-11/h2-6,10,12,14,16,18H,7-9H2,1H3/b5-4+/t10-,12-,14+/m1/s1 |
| InChIKey | USTXPFMBDNGYRR-VYLAKEIESA-N |
| XLogP | 0.12 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|