C17H25NO5 — CID 171147067
N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 171147067) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 171147067 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]-3-(furan-2-yl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | CC(C)CN(C[C@@H]1COC[C@@H](O)[C@H]1O)C(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C17H25NO5/c1-12(2)8-18(9-13-10-22-11-15(19)17(13)21)16(20)6-5-14-4-3-7-23-14/h3-7,12-13,15,17,19,21H,8-11H2,1-2H3/t13-,15-,17+/m1/s1 |
| InChIKey | BROJXJBUSBTXGR-UNEWFSDZSA-N |
| XLogP | 1.15 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|