C16H23NO4 — CID 82326317
3-[[(E)-3-(furan-2-yl)prop-2-enoyl]-(3-methylbutyl)amino]-2-methylpropanoic acid (PubChem CID 82326317) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]-(3-methylbutyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]-(3-methylbutyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82326317 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]-(3-methylbutyl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)CCN(CC(C)C(=O)O)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C16H23NO4/c1-12(2)8-9-17(11-13(3)16(19)20)15(18)7-6-14-5-4-10-21-14/h4-7,10,12-13H,8-9,11H2,1-3H3,(H,19,20)/b7-6+ |
| InChIKey | HTQLNNUFUHQGHV-VOTSOKGWSA-N |
| XLogP | 2.89 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|