C18H27F — CID 177342818
1-ethyl-3-(2-fluoropropan-2-yl)-2-(5-methylhex-5-enyl)benzene (PubChem CID 177342818) has the molecular formula C18H27F and a molecular weight of 262.41 g/mol. Its IUPAC name is 1-ethyl-3-(2-fluoropropan-2-yl)-2-(5-methylhex-5-enyl)benzene.
| Compound Name | 1-ethyl-3-(2-fluoropropan-2-yl)-2-(5-methylhex-5-enyl)benzene |
|---|---|
| PubChem CID | 177342818 |
| Molecular Formula | C18H27F |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 1-ethyl-3-(2-fluoropropan-2-yl)-2-(5-methylhex-5-enyl)benzene |
| SMILES | C=C(C)CCCCc1c(CC)cccc1C(C)(C)F |
| InChI | InChI=1S/C18H27F/c1-6-15-11-9-13-17(18(4,5)19)16(15)12-8-7-10-14(2)3/h9,11,13H,2,6-8,10,12H2,1,3-5H3 |
| InChIKey | RVHLPEYLFOIZSS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|