C43H46BN7O4 — CID 177343972
CID 177343972 (PubChem CID 177343972) has the molecular formula C43H46BN7O4 and a molecular weight of 735.70 g/mol.
| Compound Name | CID 177343972 |
|---|---|
| PubChem CID | 177343972 |
| Molecular Formula | C43H46BN7O4 |
| Molecular Weight | 735.70 g/mol |
| Exact Mass | 735.37 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc2c(cc1C(=C/N)/C=N/C1CCN(c3ccc4c(c3)CCN(C3CCC(=O)NC3=O)C4=O)CC1)CCCN2c1cccc2c1cc(C)c(=O)n2C |
| InChI | InChI=1S/C43H46BN7O4/c1-26-19-35-36(48(2)42(26)54)6-3-7-37(35)50-15-4-5-28-21-34(29(23-44)22-39(28)50)30(24-45)25-46-31-13-16-49(17-14-31)32-8-9-33-27(20-32)12-18-51(43(33)55)38-10-11-40(52)47-41(38)53/h3,6-9,19-22,24-25,31,38H,4-5,10-18,23,45H2,1-2H3,(H,47,52,53)/b30-24+,46-25+ |
| InChIKey | GPIZXYUMKFWJEI-KLMCLUMZSA-N |
| XLogP | 4.44 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|