C17H17FN4O2S — CID 177346072
[3-fluoro-5-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-diimino-methyl-λ6-sulfane (PubChem CID 177346072) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is [3-fluoro-5-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-diimino-methyl-λ6-sulfane.
| Compound Name | [3-fluoro-5-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-diimino-methyl-λ6-sulfane |
|---|---|
| PubChem CID | 177346072 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [3-fluoro-5-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-diimino-methyl-λ6-sulfane |
| SMILES | [H]N=S(C)(=N[H])c1cc(F)cc(COc2ncnc3cc(OC)ccc23)c1 |
| InChI | InChI=1S/C17H17FN4O2S/c1-23-13-3-4-15-16(8-13)21-10-22-17(15)24-9-11-5-12(18)7-14(6-11)25(2,19)20/h3-8,10,19-20H,9H2,1-2H3 |
| InChIKey | DMEBKXMONMKLEE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |