C19H20N4O2S — CID 177346125
cyclopropyl-diimino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-λ6-sulfane (PubChem CID 177346125) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is cyclopropyl-diimino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-λ6-sulfane.
| Compound Name | cyclopropyl-diimino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 177346125 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | cyclopropyl-diimino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-λ6-sulfane |
| SMILES | [H]N=S(=N[H])(c1cccc(COc2ncnc3cc(OC)ccc23)c1)C1CC1 |
| InChI | InChI=1S/C19H20N4O2S/c1-24-14-5-8-17-18(10-14)22-12-23-19(17)25-11-13-3-2-4-16(9-13)26(20,21)15-6-7-15/h2-5,8-10,12,15,20-21H,6-7,11H2,1H3 |
| InChIKey | ZAAAYBQJARVZET-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |