C21H24N4O3S — CID 91567277
7-[[3-(amino-ethylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-N-cyclopropyl-6-methoxyquinazolin-4-amine (PubChem CID 91567277) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 7-[[3-(amino-ethylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-N-cyclopropyl-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[3-(amino-ethylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-N-cyclopropyl-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 91567277 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 7-[[3-(amino-ethylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-N-cyclopropyl-6-methoxyquinazolin-4-amine |
| SMILES | CC=S(N)(=O)c1cccc(COc2cc3ncnc(NC4CC4)c3cc2OC)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-3-29(22,26)16-6-4-5-14(9-16)12-28-20-11-18-17(10-19(20)27-2)21(24-13-23-18)25-15-7-8-15/h3-6,9-11,13,15H,7-8,12H2,1-2H3,(H2,22,26)(H,23,24,25) |
| InChIKey | VZNMYUCCWIAONS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|