C18H25N3O4S — CID 158306742
[4-[(6,7-dimethoxyquinolin-4-yl)amino]cyclohexyl]methanesulfonamide (PubChem CID 158306742) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is [4-[(6,7-dimethoxyquinolin-4-yl)amino]cyclohexyl]methanesulfonamide.
| Compound Name | [4-[(6,7-dimethoxyquinolin-4-yl)amino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 158306742 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [4-[(6,7-dimethoxyquinolin-4-yl)amino]cyclohexyl]methanesulfonamide |
| SMILES | COc1cc2nccc(NC3CCC(CS(N)(=O)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C18H25N3O4S/c1-24-17-9-14-15(7-8-20-16(14)10-18(17)25-2)21-13-5-3-12(4-6-13)11-26(19,22)23/h7-10,12-13H,3-6,11H2,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | GNECCLLTEBNMNI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |