C18H16F2N2O5S — CID 157237576
[4-(6,7-dimethoxyquinolin-4-yl)oxy-3,5-difluorophenyl]methanesulfonamide (PubChem CID 157237576) has the molecular formula C18H16F2N2O5S and a molecular weight of 410.40 g/mol. Its IUPAC name is [4-(6,7-dimethoxyquinolin-4-yl)oxy-3,5-difluorophenyl]methanesulfonamide.
| Compound Name | [4-(6,7-dimethoxyquinolin-4-yl)oxy-3,5-difluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 157237576 |
| Molecular Formula | C18H16F2N2O5S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [4-(6,7-dimethoxyquinolin-4-yl)oxy-3,5-difluorophenyl]methanesulfonamide |
| SMILES | COc1cc2nccc(Oc3c(F)cc(CS(N)(=O)=O)cc3F)c2cc1OC |
| InChI | InChI=1S/C18H16F2N2O5S/c1-25-16-7-11-14(8-17(16)26-2)22-4-3-15(11)27-18-12(19)5-10(6-13(18)20)9-28(21,23)24/h3-8H,9H2,1-2H3,(H2,21,23,24) |
| InChIKey | AUUXPMLOLCSBCC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |