C17H22N3O4S- — CID 155099947
6,7-dimethoxy-4-[[4-(sulfinatoamino)cyclohexyl]amino]quinoline (PubChem CID 155099947) has the molecular formula C17H22N3O4S- and a molecular weight of 364.45 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[[4-(sulfinatoamino)cyclohexyl]amino]quinoline.
| Compound Name | 6,7-dimethoxy-4-[[4-(sulfinatoamino)cyclohexyl]amino]quinoline |
|---|---|
| PubChem CID | 155099947 |
| Molecular Formula | C17H22N3O4S- |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 6,7-dimethoxy-4-[[4-(sulfinatoamino)cyclohexyl]amino]quinoline |
| SMILES | COc1cc2nccc(NC3CCC(NS(=O)[O-])CC3)c2cc1OC |
| InChI | InChI=1S/C17H23N3O4S/c1-23-16-9-13-14(7-8-18-15(13)10-17(16)24-2)19-11-3-5-12(6-4-11)20-25(21)22/h7-12,20H,3-6H2,1-2H3,(H,18,19)(H,21,22)/p-1 |
| InChIKey | ZMMWIEMZFIZASD-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|