C19H19BrN4O2S — CID 90882771
7-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-6-bromo-N-cyclopropylquinazolin-4-amine (PubChem CID 90882771) has the molecular formula C19H19BrN4O2S and a molecular weight of 447.36 g/mol. Its IUPAC name is 7-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-6-bromo-N-cyclopropylquinazolin-4-amine.
| Compound Name | 7-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-6-bromo-N-cyclopropylquinazolin-4-amine |
|---|---|
| PubChem CID | 90882771 |
| Molecular Formula | C19H19BrN4O2S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 7-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methoxy]-6-bromo-N-cyclopropylquinazolin-4-amine |
| SMILES | C=S(N)(=O)c1cccc(COc2cc3ncnc(NC4CC4)c3cc2Br)c1 |
| InChI | InChI=1S/C19H19BrN4O2S/c1-27(21,25)14-4-2-3-12(7-14)10-26-18-9-17-15(8-16(18)20)19(23-11-22-17)24-13-5-6-13/h2-4,7-9,11,13H,1,5-6,10H2,(H2,21,25)(H,22,23,24) |
| InChIKey | KWAXBZRQAGPSPO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|