C19H23N5OS — CID 91424513
7-N-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-4-N-propan-2-ylquinazoline-4,7-diamine (PubChem CID 91424513) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 7-N-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-4-N-propan-2-ylquinazoline-4,7-diamine.
| Compound Name | 7-N-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-4-N-propan-2-ylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 91424513 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 7-N-[[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-4-N-propan-2-ylquinazoline-4,7-diamine |
| SMILES | C=S(N)(=O)c1cccc(CNc2ccc3c(NC(C)C)ncnc3c2)c1 |
| InChI | InChI=1S/C19H23N5OS/c1-13(2)24-19-17-8-7-15(10-18(17)22-12-23-19)21-11-14-5-4-6-16(9-14)26(3,20)25/h4-10,12-13,21H,3,11H2,1-2H3,(H2,20,25)(H,22,23,24) |
| InChIKey | KDCAKHZOCDQOLW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|