C27H25N5O5S — CID 90990151
ethyl N-[[3-[[4-(3-cyanoanilino)-6-methoxyquinazolin-7-yl]oxymethyl]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate (PubChem CID 90990151) has the molecular formula C27H25N5O5S and a molecular weight of 531.59 g/mol. Its IUPAC name is ethyl N-[[3-[[4-(3-cyanoanilino)-6-methoxyquinazolin-7-yl]oxymethyl]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate.
| Compound Name | ethyl N-[[3-[[4-(3-cyanoanilino)-6-methoxyquinazolin-7-yl]oxymethyl]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate |
|---|---|
| PubChem CID | 90990151 |
| Molecular Formula | C27H25N5O5S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | ethyl N-[[3-[[4-(3-cyanoanilino)-6-methoxyquinazolin-7-yl]oxymethyl]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate |
| SMILES | C=S(=O)(NC(=O)OCC)c1cccc(COc2cc3ncnc(Nc4cccc(C#N)c4)c3cc2OC)c1 |
| InChI | InChI=1S/C27H25N5O5S/c1-4-36-27(33)32-38(3,34)21-10-6-8-19(12-21)16-37-25-14-23-22(13-24(25)35-2)26(30-17-29-23)31-20-9-5-7-18(11-20)15-28/h5-14,17H,3-4,16H2,1-2H3,(H,29,30,31)(H,32,33,34) |
| InChIKey | ORMFFBJKYHDRBP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|