C19H19N3O3S — CID 177346013
cyclopropyl-imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-oxo-λ6-sulfane (PubChem CID 177346013) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is cyclopropyl-imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-oxo-λ6-sulfane.
| Compound Name | cyclopropyl-imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 177346013 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | cyclopropyl-imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-oxo-λ6-sulfane |
| SMILES | [H]N=S(=O)(c1cccc(COc2ncnc3cc(OC)ccc23)c1)C1CC1 |
| InChI | InChI=1S/C19H19N3O3S/c1-24-14-5-8-17-18(10-14)21-12-22-19(17)25-11-13-3-2-4-16(9-13)26(20,23)15-6-7-15/h2-5,8-10,12,15,20H,6-7,11H2,1H3 |
| InChIKey | QCBJQLZKVUCFJO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |