C40H51B2N11O3 — CID 177346916
CID 177346916 (PubChem CID 177346916) has the molecular formula C40H51B2N11O3 and a molecular weight of 755.55 g/mol.
| Compound Name | CID 177346916 |
|---|---|
| PubChem CID | 177346916 |
| Molecular Formula | C40H51B2N11O3 |
| Molecular Weight | 755.55 g/mol |
| Exact Mass | 755.44 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1cccc(C(=O)N(C)C)n1)N1CCC(n2ncc3c2C(CC)N(C)c2c(NC(/C=C(\N)NC(=O)C4CC4)=C(/N)C(=O)NC4CC4)cccc2-3)CC1C |
| InChI | InChI=1S/C40H51B2N11O3/c1-6-31-36-27(21-45-53(36)25-17-18-52(22(2)19-25)40(41,42)32-12-8-11-29(48-32)39(56)50(3)4)26-9-7-10-28(35(26)51(31)5)47-30(34(44)38(55)46-24-15-16-24)20-33(43)49-37(54)23-13-14-23/h7-12,20-25,31,47H,6,13-19,43-44H2,1-5H3,(H,46,55)(H,49,54)/b33-20+,34-30+ |
| InChIKey | PHDOYWPZUSLSHL-QYASEXOOSA-N |
| XLogP | 2.91 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|