C36H44BN11O4 — CID 177348889
CID 177348889 (PubChem CID 177348889) has the molecular formula C36H44BN11O4 and a molecular weight of 705.63 g/mol.
| Compound Name | CID 177348889 |
|---|---|
| PubChem CID | 177348889 |
| Molecular Formula | C36H44BN11O4 |
| Molecular Weight | 705.63 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1cccc(C(=O)N(C)CC)n1)N1CC(n2ncc3c2CN(C)c2c(NC(/C=C(\N)NC(=O)C4CC4)=C(/N)C(=O)NC4CC4)cccc2-3)C1 |
| InChI | InChI=1S/C36H44BN11O4/c1-4-45(2)35(51)26-9-6-10-29(43-26)36(37,52)47-17-22(18-47)48-28-19-46(3)32-23(24(28)16-40-48)7-5-8-25(32)42-27(31(39)34(50)41-21-13-14-21)15-30(38)44-33(49)20-11-12-20/h5-10,15-16,20-22,42,52H,4,11-14,17-19,38-39H2,1-3H3,(H,41,50)(H,44,49)/b30-15+,31-27+ |
| InChIKey | BYWLBDPVZAXEAJ-IWXYBSNRSA-N |
| XLogP | 1.00 |
| TPSA | 200.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.63 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|