C38H53BN10O5S — CID 177347483
CID 177347483 (PubChem CID 177347483) has the molecular formula C38H53BN10O5S and a molecular weight of 772.79 g/mol.
| Compound Name | CID 177347483 |
|---|---|
| PubChem CID | 177347483 |
| Molecular Formula | C38H53BN10O5S |
| Molecular Weight | 772.79 g/mol |
| Exact Mass | 772.40 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]C(O)(c1cccc(S(=O)(=O)CC)n1)N1CC(n2ncc3c2CN(C)c2c(NC(/C=C(\N)NC(=O)C4CC4)=C(/N)C(=O)NC4CC4)cccc2-3)C1 |
| InChI | InChI=1S/C34H41BN10O5S.2C2H6/c1-3-51(49,50)29-9-5-8-27(41-29)34(35,48)44-16-21(17-44)45-26-18-43(2)31-22(23(26)15-38-45)6-4-7-24(31)40-25(30(37)33(47)39-20-12-13-20)14-28(36)42-32(46)19-10-11-19;2*1-2/h4-9,14-15,19-21,40,48H,3,10-13,16-18,36-37H2,1-2H3,(H,39,47)(H,42,46);2*1-2H3/b28-14+,30-25+;; |
| InChIKey | AGKYXSCHUVWETB-OWKZSLTQSA-N |
| XLogP | 2.76 |
| TPSA | 213.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|