C34H39BN10O5S — CID 177348568
CID 177348568 (PubChem CID 177348568) has the molecular formula C34H39BN10O5S and a molecular weight of 710.63 g/mol.
| Compound Name | CID 177348568 |
|---|---|
| PubChem CID | 177348568 |
| Molecular Formula | C34H39BN10O5S |
| Molecular Weight | 710.63 g/mol |
| Exact Mass | 710.29 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1cccc(S(=O)(=O)CC)n1)N1CC(n2ncc3c2C(CC)N(C)c2c(Nc4cc(NC(=O)C5CC5)nnc4C(=O)NC)cccc2-3)C1 |
| InChI | InChI=1S/C34H39BN10O5S/c1-5-25-31-22(16-37-45(31)20-17-44(18-20)34(35,48)26-11-8-12-28(39-26)51(49,50)6-2)21-9-7-10-23(30(21)43(25)4)38-24-15-27(40-32(46)19-13-14-19)41-42-29(24)33(47)36-3/h7-12,15-16,19-20,25,48H,5-6,13-14,17-18H2,1-4H3,(H,36,47)(H2,38,40,41,46) |
| InChIKey | OYKHKOUSLKAWOB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 187.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|