C34H39B2N11O3 — CID 177347020
CID 177347020 (PubChem CID 177347020) has the molecular formula C34H39B2N11O3 and a molecular weight of 671.38 g/mol.
| Compound Name | CID 177347020 |
|---|---|
| PubChem CID | 177347020 |
| Molecular Formula | C34H39B2N11O3 |
| Molecular Weight | 671.38 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])(c1cccc(C(=O)NC)n1)N1CC(n2ncc3c2CN(C)c2c(Nc4cc(NC(=O)C5CC5)nnc4C(=O)NC)cccc2-3)C1 |
| InChI | InChI=1S/C32H33B2N11O3.C2H6/c1-35-30(47)22-8-5-9-25(39-22)32(33,34)44-14-18(15-44)45-24-16-43(3)28-19(20(24)13-37-45)6-4-7-21(28)38-23-12-26(40-29(46)17-10-11-17)41-42-27(23)31(48)36-2;1-2/h4-9,12-13,17-18H,10-11,14-16H2,1-3H3,(H,35,47)(H,36,48)(H2,38,40,41,46);1-2H3 |
| InChIKey | WFPFIOZAWFJQEQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|