C34H38B2N10O4S — CID 177347574
CID 177347574 (PubChem CID 177347574) has the molecular formula C34H38B2N10O4S and a molecular weight of 704.44 g/mol.
| Compound Name | CID 177347574 |
|---|---|
| PubChem CID | 177347574 |
| Molecular Formula | C34H38B2N10O4S |
| Molecular Weight | 704.44 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1cccc(S(=O)(=O)CC)n1)N1CC(n2ncc3c2C(CC)N(C)c2c(Nc4cc(NC(=O)C5CC5)nnc4C(=O)NC)cccc2-3)C1 |
| InChI | InChI=1S/C34H38B2N10O4S/c1-5-25-31-22(16-38-46(31)20-17-45(18-20)34(35,36)26-11-8-12-28(40-26)51(49,50)6-2)21-9-7-10-23(30(21)44(25)4)39-24-15-27(41-32(47)19-13-14-19)42-43-29(24)33(48)37-3/h7-12,15-16,19-20,25H,5-6,13-14,17-18H2,1-4H3,(H,37,48)(H2,39,41,42,47) |
| InChIKey | UPICIDBPEHWBIV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 167.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|