C33H35BN10O4 — CID 177347911
CID 177347911 (PubChem CID 177347911) has the molecular formula C33H35BN10O4 and a molecular weight of 646.52 g/mol.
| Compound Name | CID 177347911 |
|---|---|
| PubChem CID | 177347911 |
| Molecular Formula | C33H35BN10O4 |
| Molecular Weight | 646.52 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1cccc(C=O)n1)N1CC(n2ncc3c2C(CC)N(C)c2c(Nc4cc(NC(=O)C5CC5)nnc4C(=O)NC)cccc2-3)C1 |
| InChI | InChI=1S/C33H35BN10O4/c1-4-25-30-22(14-36-44(30)20-15-43(16-20)33(34,48)26-10-5-7-19(17-45)37-26)21-8-6-9-23(29(21)42(25)3)38-24-13-27(39-31(46)18-11-12-18)40-41-28(24)32(47)35-2/h5-10,13-14,17-18,20,25,48H,4,11-12,15-16H2,1-3H3,(H,35,47)(H2,38,39,40,46) |
| InChIKey | GAPXCVMJETUKMU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|