C35H39B2N11O2 — CID 177348835
CID 177348835 (PubChem CID 177348835) has the molecular formula C35H39B2N11O2 and a molecular weight of 667.40 g/mol.
| Compound Name | CID 177348835 |
|---|---|
| PubChem CID | 177348835 |
| Molecular Formula | C35H39B2N11O2 |
| Molecular Weight | 667.40 g/mol |
| Exact Mass | 667.35 |
| IUPAC Name | — |
| SMILES | CNC.[B]C([B])(c1cccc(C=O)n1)N1CC(n2ncc3c2C(C)N(C)c2c(Nc4cc(NC(=O)C5CC5)nc5cc(C)nn45)cccc2-3)C1 |
| InChI | InChI=1S/C33H32B2N10O2.C2H7N/c1-18-12-28-39-27(40-32(47)20-10-11-20)13-29(45(28)41-18)38-25-8-5-7-23-24-14-36-44(30(24)19(2)42(3)31(23)25)22-15-43(16-22)33(34,35)26-9-4-6-21(17-46)37-26;1-3-2/h4-9,12-14,17,19-20,22,38H,10-11,15-16H2,1-3H3,(H,39,40,47);3H,1-2H3 |
| InChIKey | ADRCMNVQQAQKHG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|