C35H36B2N10O3 — CID 177348943
CID 177348943 (PubChem CID 177348943) has the molecular formula C35H36B2N10O3 and a molecular weight of 666.36 g/mol.
| Compound Name | CID 177348943 |
|---|---|
| PubChem CID | 177348943 |
| Molecular Formula | C35H36B2N10O3 |
| Molecular Weight | 666.36 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1cccc(C=O)n1)N1CC(n2ncc3c2C(CC)N(C)c2c(Nc4cc(NC(=O)C5CC5)nnc4C(=O)NC4CC4)cccc2-3)C1 |
| InChI | InChI=1S/C35H36B2N10O3/c1-3-27-32-24(15-38-47(32)22-16-46(17-22)35(36,37)28-9-4-6-21(18-48)39-28)23-7-5-8-25(31(23)45(27)2)41-26-14-29(42-33(49)19-10-11-19)43-44-30(26)34(50)40-20-12-13-20/h4-9,14-15,18-20,22,27H,3,10-13,16-17H2,1-2H3,(H,40,50)(H2,41,42,43,49) |
| InChIKey | LXUNFOIWGHFHRD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 150.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|