C36H43B2N11O2 — CID 177348969
CID 177348969 (PubChem CID 177348969) has the molecular formula C36H43B2N11O2 and a molecular weight of 683.44 g/mol.
| Compound Name | CID 177348969 |
|---|---|
| PubChem CID | 177348969 |
| Molecular Formula | C36H43B2N11O2 |
| Molecular Weight | 683.44 g/mol |
| Exact Mass | 683.38 |
| IUPAC Name | — |
| SMILES | CNC.O=CC1CC1.[B]C([B])(c1cccc(C=O)n1)N1CC(n2ncc3c2[C@@H](C)N(C)c2c(Nc4cc(NC)nc5cc(C)nn45)cccc2-3)C1 |
| InChI | InChI=1S/C30H30B2N10O.C4H6O.C2H7N/c1-17-11-26-37-25(33-3)12-27(42(26)38-17)36-23-9-6-8-21-22-13-34-41(28(22)18(2)39(4)29(21)23)20-14-40(15-20)30(31,32)24-10-5-7-19(16-43)35-24;5-3-4-1-2-4;1-3-2/h5-13,16,18,20,36H,14-15H2,1-4H3,(H,33,37);3-4H,1-2H2;3H,1-2H3/t18-;;/m1../s1 |
| InChIKey | SELAFYYWEQSDSP-JPKZNVRTSA-N |
| XLogP | 3.84 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|