C36H43B2N13O2 — CID 177348730
CID 177348730 (PubChem CID 177348730) has the molecular formula C36H43B2N13O2 and a molecular weight of 711.45 g/mol.
| Compound Name | CID 177348730 |
|---|---|
| PubChem CID | 177348730 |
| Molecular Formula | C36H43B2N13O2 |
| Molecular Weight | 711.45 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1cccc(C(=O)N2CCCC2)n1)N1CC(n2ncc3c2C(C)N(C)c2c(NC(/C=C(\N)Nc4cnn(C)c4)=C(/N)C(=O)NC)cccc2-3)C1 |
| InChI | InChI=1S/C36H43B2N13O2/c1-21-32-25(17-43-51(32)23-19-50(20-23)36(37,38)29-12-8-11-27(46-29)35(53)49-13-5-6-14-49)24-9-7-10-26(33(24)48(21)4)45-28(31(40)34(52)41-2)15-30(39)44-22-16-42-47(3)18-22/h7-12,15-18,21,23,44-45H,5-6,13-14,19-20,39-40H2,1-4H3,(H,41,52)/b30-15+,31-28+ |
| InChIKey | FNNPWRMTOXGGKP-WUIBPDFCSA-N |
| XLogP | 1.67 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|