C37H43B2N11O3 — CID 177347580
CID 177347580 (PubChem CID 177347580) has the molecular formula C37H43B2N11O3 and a molecular weight of 711.45 g/mol.
| Compound Name | CID 177347580 |
|---|---|
| PubChem CID | 177347580 |
| Molecular Formula | C37H43B2N11O3 |
| Molecular Weight | 711.45 g/mol |
| Exact Mass | 711.37 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1cccc(C(=O)N2CCCC2)n1)N1CC(n2ncc3c2CN(C)c2c(NC(/C=C(\N)NC(=O)C4CC4)=C(/N)C(=O)NC4CC4)cccc2-3)C1 |
| InChI | InChI=1S/C37H43B2N11O3/c1-47-20-29-25(17-42-50(29)23-18-49(19-23)37(38,39)30-9-5-8-27(45-30)36(53)48-14-2-3-15-48)24-6-4-7-26(33(24)47)44-28(32(41)35(52)43-22-12-13-22)16-31(40)46-34(51)21-10-11-21/h4-9,16-17,21-23,44H,2-3,10-15,18-20,40-41H2,1H3,(H,43,52)(H,46,51)/b31-16+,32-28+ |
| InChIKey | AWVGVAHOZPOUPS-LPOAASNZSA-N |
| XLogP | 1.32 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|