C37H38B2N10O2 — CID 177347119
CID 177347119 (PubChem CID 177347119) has the molecular formula C37H38B2N10O2 and a molecular weight of 676.40 g/mol.
| Compound Name | CID 177347119 |
|---|---|
| PubChem CID | 177347119 |
| Molecular Formula | C37H38B2N10O2 |
| Molecular Weight | 676.40 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1cccc(C=O)n1)N1CC(n2ncc3c2C(C)N(C)c2c(Nc4cc(NC)nnc4C(=O)NC)cc(-c4c(C)cccc4C)cc2-3)C1 |
| InChI | InChI=1S/C37H38B2N10O2/c1-20-9-7-10-21(2)32(20)23-13-26-27-16-42-49(25-17-48(18-25)37(38,39)30-12-8-11-24(19-50)43-30)34(27)22(3)47(6)35(26)29(14-23)44-28-15-31(40-4)45-46-33(28)36(51)41-5/h7-16,19,22,25H,17-18H2,1-6H3,(H,41,51)(H2,40,44,45) |
| InChIKey | PDLVNXHJEBSKDL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|