C11H14N2 — CID 177348824
7-butan-2-ylpyrazolo[1,5-a]pyridine (PubChem CID 177348824) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 7-butan-2-ylpyrazolo[1,5-a]pyridine.
| Compound Name | 7-butan-2-ylpyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 177348824 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7-butan-2-ylpyrazolo[1,5-a]pyridine |
| SMILES | CCC(C)c1cccc2ccnn12 |
| InChI | InChI=1S/C11H14N2/c1-3-9(2)11-6-4-5-10-7-8-12-13(10)11/h4-9H,3H2,1-2H3 |
| InChIKey | LDMACUSWOGFUOA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |