C26H29N5OS — CID 177349036
5-[2-[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]ethyl]-N-(4-propan-2-ylphenyl)sulfanylpyridin-2-amine (PubChem CID 177349036) has the molecular formula C26H29N5OS and a molecular weight of 459.62 g/mol. Its IUPAC name is 5-[2-[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]ethyl]-N-(4-propan-2-ylphenyl)sulfanylpyridin-2-amine.
| Compound Name | 5-[2-[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]ethyl]-N-(4-propan-2-ylphenyl)sulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 177349036 |
| Molecular Formula | C26H29N5OS |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 5-[2-[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]ethyl]-N-(4-propan-2-ylphenyl)sulfanylpyridin-2-amine |
| SMILES | COc1cc(CCc2ccc(NSc3ccc(C(C)C)cc3)nc2)ccc1-c1cnc(N)[nH]1 |
| InChI | InChI=1S/C26H29N5OS/c1-17(2)20-8-10-21(11-9-20)33-31-25-13-7-19(15-28-25)5-4-18-6-12-22(24(14-18)32-3)23-16-29-26(27)30-23/h6-17H,4-5H2,1-3H3,(H,28,31)(H3,27,29,30) |
| InChIKey | AYJJYFKRZDJEPT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|