C25H25N5O2S — CID 177349110
N-[[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]methyl]-2-[4-(phenylsulfanylamino)phenyl]acetamide (PubChem CID 177349110) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is N-[[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]methyl]-2-[4-(phenylsulfanylamino)phenyl]acetamide.
| Compound Name | N-[[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]methyl]-2-[4-(phenylsulfanylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 177349110 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[[4-(2-amino-1H-imidazol-5-yl)-3-methoxyphenyl]methyl]-2-[4-(phenylsulfanylamino)phenyl]acetamide |
| SMILES | COc1cc(CNC(=O)Cc2ccc(NSc3ccccc3)cc2)ccc1-c1cnc(N)[nH]1 |
| InChI | InChI=1S/C25H25N5O2S/c1-32-23-13-18(9-12-21(23)22-16-28-25(26)29-22)15-27-24(31)14-17-7-10-19(11-8-17)30-33-20-5-3-2-4-6-20/h2-13,16,30H,14-15H2,1H3,(H,27,31)(H3,26,28,29) |
| InChIKey | ZGQRDSDCDRIEQX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|