C30H48F2N4O — CID 177355721
4-[3-fluoro-4-[1-[4-fluoro-1-(2-propylpentyl)pyrrolidin-3-yl]piperidin-4-yl]anilino]-5-(methylamino)hex-5-enal (PubChem CID 177355721) has the molecular formula C30H48F2N4O and a molecular weight of 518.74 g/mol. Its IUPAC name is 4-[3-fluoro-4-[1-[4-fluoro-1-(2-propylpentyl)pyrrolidin-3-yl]piperidin-4-yl]anilino]-5-(methylamino)hex-5-enal.
| Compound Name | 4-[3-fluoro-4-[1-[4-fluoro-1-(2-propylpentyl)pyrrolidin-3-yl]piperidin-4-yl]anilino]-5-(methylamino)hex-5-enal |
|---|---|
| PubChem CID | 177355721 |
| Molecular Formula | C30H48F2N4O |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | 4-[3-fluoro-4-[1-[4-fluoro-1-(2-propylpentyl)pyrrolidin-3-yl]piperidin-4-yl]anilino]-5-(methylamino)hex-5-enal |
| SMILES | C=C(NC)C(CCC=O)Nc1ccc(C2CCN(C3CN(CC(CCC)CCC)CC3F)CC2)c(F)c1 |
| InChI | InChI=1S/C30H48F2N4O/c1-5-8-23(9-6-2)19-35-20-28(32)30(21-35)36-15-13-24(14-16-36)26-12-11-25(18-27(26)31)34-29(10-7-17-37)22(3)33-4/h11-12,17-18,23-24,28-30,33-34H,3,5-10,13-16,19-21H2,1-2,4H3 |
| InChIKey | WFRAZHJTQIMADW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|