C25H39N5O2 — CID 177355641
2-[3-cyano-4-[4-(2-propylpentyl)piperazin-1-yl]anilino]-N-methyl-5-oxopentanamide (PubChem CID 177355641) has the molecular formula C25H39N5O2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[3-cyano-4-[4-(2-propylpentyl)piperazin-1-yl]anilino]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[3-cyano-4-[4-(2-propylpentyl)piperazin-1-yl]anilino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177355641 |
| Molecular Formula | C25H39N5O2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 2-[3-cyano-4-[4-(2-propylpentyl)piperazin-1-yl]anilino]-N-methyl-5-oxopentanamide |
| SMILES | CCCC(CCC)CN1CCN(c2ccc(NC(CCC=O)C(=O)NC)cc2C#N)CC1 |
| InChI | InChI=1S/C25H39N5O2/c1-4-7-20(8-5-2)19-29-12-14-30(15-13-29)24-11-10-22(17-21(24)18-26)28-23(9-6-16-31)25(32)27-3/h10-11,16-17,20,23,28H,4-9,12-15,19H2,1-3H3,(H,27,32) |
| InChIKey | WCKZQITWGVWVLR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|