C24H25NO5 — CID 177360993
(4R,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylic acid (PubChem CID 177360993) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (4R,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylic acid.
| Compound Name | (4R,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 177360993 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (4R,7R)-4-(3-hydroxyphenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylic acid |
| SMILES | COc1ccccc1[C@H]1CC(=O)C2C(C1)NC(C)=C(C(=O)O)[C@H]2c1cccc(O)c1 |
| InChI | InChI=1S/C24H25NO5/c1-13-21(24(28)29)22(14-6-5-7-16(26)10-14)23-18(25-13)11-15(12-19(23)27)17-8-3-4-9-20(17)30-2/h3-10,15,18,22-23,25-26H,11-12H2,1-2H3,(H,28,29)/t15-,18?,22-,23?/m1/s1 |
| InChIKey | JHKQVHZAWJLBPK-QGLKYUJRSA-N |
| XLogP | 3.58 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |